| 
 | Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741-3rd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6734±0.00558614 |  
		| Normalized OD Score: sc h | 1.0076±0.0266293 |  
		| Z-Score: | 0.2776±1.05536 |  
		| p-Value: | 0.47261 |  
		| Z-Factor: | -8.26741 |  
		| Fitness Defect: | 0.7495 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.30 Celcius |  | Date: | 2007-09-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039625±0.00079 |  | Plate DMSO Control (-): | 0.659925±0.13285 |  | Plate Z-Factor: | 0.2757 | 
 |  png ps
 pdf
 | 
 
 
	
		| 14419 | [(10S,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl] acetate
 |  
		| 101996 | [(3R,5S,8R,9S,10S,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate
 |  
		| 107497 | [(1S,5S,8S,9S,10S,13S,14S,17S)-1,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate
 |  
		| 109201 | calcium 12-acetyloxyoctadecanoate |  
		| 109202 | 12-acetyloxyoctadecanoic acid |  
		| 155547 | [(2R,5S,8S,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate
 |  
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >> | 
 
 | active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |