| Compound Information | SONAR Target prediction | | Name: | OLEANANOIC ACID ACETATE | | Unique Identifier: | SPE00240871 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H52O4 | | Molecular Weight: | 448.34 g/mol | | X log p: | 0.014 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | | Reference: | Phytochemistry 18: 1375 (1979) |
| Species: |
4932 |
| Condition: |
SET2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6981±0.00353553 |
| Normalized OD Score: sc h |
0.9769±0.00839611 |
| Z-Score: |
-1.3569±0.49709 |
| p-Value: |
0.201126 |
| Z-Factor: |
-76.4362 |
| Fitness Defect: |
1.6038 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.90 Celcius | | Date: | 2007-11-15 YYYY-MM-DD | | Plate CH Control (+): | 0.041525±0.00089 | | Plate DMSO Control (-): | 0.700725±0.08219 | | Plate Z-Factor: | 0.6272 |
| png ps pdf |
| 537145 |
9-oxononyl acetate |
| 537181 |
methyl 9-acetyloxyhenicosanoate |
| 537188 |
methyl 4-(3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17 -yl)pentanoate |
| 537634 |
[4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,5,6,7,8,9,12,15,16,17-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
| 537642 |
(2-methyl-6-oxo-heptyl) acetate |
| 537924 |
methyl 8-acetyloxyoctanoate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|