Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
MRT4 |
Replicates: |
2 |
Raw OD Value: r im |
0.5092±0.0883883 |
Normalized OD Score: sc h |
0.9657±0.017655 |
Z-Score: |
-1.0965±0.420691 |
p-Value: |
0.293788 |
Z-Factor: |
-60.2249 |
Fitness Defect: |
1.2249 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-08-30 YYYY-MM-DD | Plate CH Control (+): | 0.0395±0.00061 | Plate DMSO Control (-): | 0.5116499999999999±0.09917 | Plate Z-Factor: | 0.3262 |
| png ps pdf |
537145 |
9-oxononyl acetate |
537181 |
methyl 9-acetyloxyhenicosanoate |
537188 |
methyl 4-(3,12-diacetyloxy-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-17 -yl)pentanoate |
537634 |
[4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,5,6,7,8,9,12,15,16,17-dodecahydrocyclope nta[a]phenanthren-3-yl] acetate |
537642 |
(2-methyl-6-oxo-heptyl) acetate |
537924 |
methyl 8-acetyloxyoctanoate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|