| Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		HXT1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6949±0.00876812 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9779±0.000497484 | 
	 
	
		| Z-Score: | 
		-1.1647±0.0489043 | 
	 
	
		| p-Value: | 
		0.244416 | 
	 
	
		| Z-Factor: | 
		-23.6505 | 
	 
	
		| Fitness Defect: | 
		1.4089 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.20 Celcius |  | Date: | 2007-11-27 YYYY-MM-DD |  | Plate CH Control (+): | 0.040625±0.00042 |  | Plate DMSO Control (-): | 0.6957±0.04660 |  | Plate Z-Factor: | 0.7240 |  
  |  png ps pdf |  
 
 
	
		| 313072 | 
		methyl 4-(3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthr en-17-yl)pentanoate | 
	 
	
		| 313074 | 
		methyl 4-(3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoate | 
	 
	
		| 349178 | 
		3-(4-acetyloxycyclohexyl)propanoic acid | 
	 
	
		| 386127 | 
		n/a | 
	 
	
		| 469211 | 
		n/a | 
	 
	
		| 469654 | 
		n/a | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |