Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
COT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6769±0.00643467 |
Normalized OD Score: sc h |
0.9642±0.0138492 |
Z-Score: |
-1.8609±0.741585 |
p-Value: |
0.099225 |
Z-Factor: |
-5.2076 |
Fitness Defect: |
2.3104 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-11-20 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00105 | Plate DMSO Control (-): | 0.6809499999999999±0.03345 | Plate Z-Factor: | 0.8541 |
| png ps pdf |
313072 |
methyl 4-(3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthr en-17-yl)pentanoate |
313074 |
methyl 4-(3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoate |
349178 |
3-(4-acetyloxycyclohexyl)propanoic acid |
386127 |
n/a |
469211 |
n/a |
469654 |
n/a |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|