Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
ROT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8207±0.000565685 |
Normalized OD Score: sc h |
0.9975±0.000969941 |
Z-Score: |
-0.1164±0.0474265 |
p-Value: |
0.907408 |
Z-Factor: |
-60.4898 |
Fitness Defect: |
0.0972 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2006-05-05 YYYY-MM-DD | Plate CH Control (+): | 0.038900000000000004±0.00247 | Plate DMSO Control (-): | 0.79365±0.01895 | Plate Z-Factor: | 0.9197 |
| png ps pdf |
11944640 |
methyl (4R)-4-[(3R,5R,8S,9S,10S,12S,13R,14S,17R)-3-acetyloxy-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14 ,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
13200866 |
methyl (4R)-4-[(3R,5R,8S,9S,10S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
16056193 |
[(4S)-4-ethyl-6-oxo-heptyl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|