| Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MT2481-pdr1pdr3-2nd | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5518±0.0159806 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9920±0.0264429 | 
	 
	
		| Z-Score: | 
		-0.3247±1.14874 | 
	 
	
		| p-Value: | 
		0.4407 | 
	 
	
		| Z-Factor: | 
		-15.7381 | 
	 
	
		| Fitness Defect: | 
		0.8194 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.30 Celcius |  | Date: | 2007-09-27 YYYY-MM-DD |  | Plate CH Control (+): | 0.039825±0.00175 |  | Plate DMSO Control (-): | 0.544975±0.10154 |  | Plate Z-Factor: | 0.3552 |  
  |  png ps pdf |  
 
 
	
		| 7203538 | 
		(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 7203539 | 
		(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 7203540 | 
		(4R)-4-[(3R,5R,8R,9S,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 7203541 | 
		(4R)-4-[(3R,5R,8R,9S,10S,13R,14R,17R)-3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | 
	 
	
		| 7213460 | 
		[(5S,8S,9R,10S,13S,14S,17R)-10,13-dimethyl-2-oxo-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclope nta[a]phenanthren-17-yl] acetate | 
	 
	
		| 7213462 | 
		[(5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-2-oxo-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclope nta[a]phenanthren-17-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |