| Compound Information | SONAR Target prediction | | Name: | OLEANANOIC ACID ACETATE | | Unique Identifier: | SPE00240871 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H52O4 | | Molecular Weight: | 448.34 g/mol | | X log p: | 0.014 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | | Reference: | Phytochemistry 18: 1375 (1979) |
| Species: |
4932 |
| Condition: |
GCN5 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2742±0.0270115 |
| Normalized OD Score: sc h |
1.0498±0.00978687 |
| Z-Score: |
0.8537±0.161915 |
| p-Value: |
0.396386 |
| Z-Factor: |
-4.03491 |
| Fitness Defect: |
0.9254 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-10-30 YYYY-MM-DD | | Plate CH Control (+): | 0.041425000000000003±0.00082 | | Plate DMSO Control (-): | 0.2666±0.05913 | | Plate Z-Factor: | 0.1011 |
| png ps pdf |
| 7056468 |
[(3R,5S,8R,9S,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| 7056469 |
[(3R,5S,8S,9S,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| 7056560 |
[(3S,5S,8R,9R,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| 7056561 |
[(3S,5S,8S,9R,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| 7056562 |
[(3S,5S,8R,9S,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| 7056563 |
[(3S,5S,8S,9S,10S,13S,14S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyc lopenta[a]phenanthren-3-yl] acetate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|