| Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		PPZ1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8246±0.00523259 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0023±0.00435843 | 
	 
	
		| Z-Score: | 
		0.1145±0.216929 | 
	 
	
		| p-Value: | 
		0.87888 | 
	 
	
		| Z-Factor: | 
		-27.3254 | 
	 
	
		| Fitness Defect: | 
		0.1291 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2006-05-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.03862500000000001±0.00186 |  | Plate DMSO Control (-): | 0.7978000000000001±0.01228 |  | Plate Z-Factor: | 0.9577 |  
  |  png ps pdf |  
 
 
	
		| 7052836 | 
		[(3R,5S,8R,9S,10S,13S,14R,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 7052837 | 
		[(3R,5S,8R,9S,10S,13S,14R,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 7052838 | 
		[(3R,5S,8R,9S,10S,13S,14S,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 7052839 | 
		[(3R,5S,8R,9S,10S,13S,14S,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate | 
	 
	
		| 7052887 | 
		[(5R,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate | 
	 
	
		| 7052888 | 
		[(5S,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |