Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
GCN5 |
Replicates: |
2 |
Raw OD Value: r im |
0.2742±0.0270115 |
Normalized OD Score: sc h |
1.0498±0.00978687 |
Z-Score: |
0.8537±0.161915 |
p-Value: |
0.396386 |
Z-Factor: |
-4.03491 |
Fitness Defect: |
0.9254 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-10-30 YYYY-MM-DD | Plate CH Control (+): | 0.041425000000000003±0.00082 | Plate DMSO Control (-): | 0.2666±0.05913 | Plate Z-Factor: | 0.1011 |
| png ps pdf |
7052836 |
[(3R,5S,8R,9S,10S,13S,14R,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052837 |
[(3R,5S,8R,9S,10S,13S,14R,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052838 |
[(3R,5S,8R,9S,10S,13S,14S,16R)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052839 |
[(3R,5S,8R,9S,10S,13S,14S,16S)-10,13,16-trimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-3-yl] acetate |
7052887 |
[(5R,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
7052888 |
[(5S,7R,8S,9S,10R,13R,14S,17S)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydroc yclopenta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|