| Compound Information | SONAR Target prediction | | Name: | OLEANANOIC ACID ACETATE | | Unique Identifier: | SPE00240871 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H52O4 | | Molecular Weight: | 448.34 g/mol | | X log p: | 0.014 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | | Reference: | Phytochemistry 18: 1375 (1979) |
| Species: |
4932 |
| Condition: |
LGE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7044±0.0323855 |
| Normalized OD Score: sc h |
1.0553±0.032792 |
| Z-Score: |
0.9115±0.470739 |
| p-Value: |
0.388126 |
| Z-Factor: |
-2.64753 |
| Fitness Defect: |
0.9464 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.20 Celcius | | Date: | 2006-02-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04±0.00177 | | Plate DMSO Control (-): | 0.65785±0.06406 | | Plate Z-Factor: | 0.7682 |
| png ps pdf |
| 6432116 |
[(3R,5S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3 -yl] acetate |
| 6455695 |
8-acetyloxyoctyl acetate; hexanedioic acid |
| 6541181 |
[(3R,5S,8R,9R,10R,13R,14S)-10,13-dimethyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopen ta[a]phenanthren-3-yl] acetate |
| 6546124 |
[(5S,8R,9R,10R,13R,14S,17R)-10,13,17-trimethyl-3-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
| 6546263 |
[(5S,8R,9R,10R,13R,14S,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclope nta[a]phenanthren-17-yl] acetate |
| 6548077 |
n/a |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|