Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
SER1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6580±0.00127279 |
Normalized OD Score: sc h |
1.0828±0.0227321 |
Z-Score: |
2.5989±0.644726 |
p-Value: |
0.0171823 |
Z-Factor: |
-3.20905 |
Fitness Defect: |
4.0639 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2007-09-17 YYYY-MM-DD | Plate CH Control (+): | 0.03955±0.00064 | Plate DMSO Control (-): | 0.597125±0.11510 | Plate Z-Factor: | 0.3000 |
| png ps pdf |
250210 |
[(3S,5S,8R,9S,10S,13R,14S,17S)-17-acetyl-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahyd ro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
250213 |
[(5S,8R,9S,10S,13S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,8,9,11,12,15,16,17-dodecahydrocyclo penta[a]phenanthren-17-yl] acetate |
252015 |
(10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
252814 |
n/a |
253635 |
[(3S,5S,8R,9S,10S,13S,14S)-4,4,10,13,14-pentamethyl-17-oxo-1,2,3,5,6,7,8,9,11,12,15,16-dodecahydrocyclop enta[a]phenanthren-3-yl] acetate |
254637 |
n/a |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|