Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
TOP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6436±0.00219203 |
Normalized OD Score: sc h |
1.1473±0.0370275 |
Z-Score: |
2.3622±0.480043 |
p-Value: |
0.0249978 |
Z-Factor: |
-0.241147 |
Fitness Defect: |
3.689 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2006-04-26 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00117 | Plate DMSO Control (-): | 0.61475±0.01562 | Plate Z-Factor: | 0.8810 |
| png ps pdf |
4435347 |
[17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclo penta[a]phenanthren-3-yl] acetate |
4456041 |
2-(3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthr en-17-yl)acetic acid |
4530978 |
methyl 4-(3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl)pentanoate |
4548252 |
4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl)pentanoic acid |
4664773 |
(17-acetyl-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren -3-yl) acetate |
4668448 |
(4,4,10,13,14-pentamethyl-17-oxo-1,2,3,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|