| Compound Information | SONAR Target prediction | | Name: | OLEANANOIC ACID ACETATE | | Unique Identifier: | SPE00240871 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H52O4 | | Molecular Weight: | 448.34 g/mol | | X log p: | 0.014 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | | Reference: | Phytochemistry 18: 1375 (1979) |
| Species: |
4932 |
| Condition: |
HXT1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6949±0.00876812 |
| Normalized OD Score: sc h |
0.9779±0.000497484 |
| Z-Score: |
-1.1647±0.0489043 |
| p-Value: |
0.244416 |
| Z-Factor: |
-23.6505 |
| Fitness Defect: |
1.4089 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.20 Celcius | | Date: | 2007-11-27 YYYY-MM-DD | | Plate CH Control (+): | 0.040625±0.00042 | | Plate DMSO Control (-): | 0.6957±0.04660 | | Plate Z-Factor: | 0.7240 |
| png ps pdf |
| 4435347 |
[17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclo penta[a]phenanthren-3-yl] acetate |
| 4456041 |
2-(3-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthr en-17-yl)acetic acid |
| 4530978 |
methyl 4-(3-acetyloxy-10,13-dimethyl-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl)pentanoate |
| 4548252 |
4-(3-acetyloxy-10,13-dimethyl-12-oxo-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-17-yl)pentanoic acid |
| 4664773 |
(17-acetyl-4,4,10,13,14-pentamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren -3-yl) acetate |
| 4668448 |
(4,4,10,13,14-pentamethyl-17-oxo-1,2,3,5,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl) acetate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|