Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
RAD52 |
Replicates: |
2 |
Raw OD Value: r im |
0.5953±0.0033234 |
Normalized OD Score: sc h |
0.9871±0.0183832 |
Z-Score: |
-0.5395±0.768298 |
p-Value: |
0.637946 |
Z-Factor: |
-15.3108 |
Fitness Defect: |
0.4495 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2007-10-26 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00071 | Plate DMSO Control (-): | 0.57925±0.09215 | Plate Z-Factor: | 0.4315 |
| png ps pdf |
2754269 |
methyl (4S)-4-[(3R,5R,10S,12S,13R,17R)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrad ecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
2755046 |
(3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoic acid |
2755048 |
methyl (3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoate |
2825516 |
(10,13-dimethyl-1-oxo-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
2825571 |
1-[(5S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17 -yl]ethyl acetate |
3022911 |
ethyl 8-acetyloxyoctanoate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|