| Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		LGE1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7044±0.0323855 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0553±0.032792 | 
	 
	
		| Z-Score: | 
		0.9115±0.470739 | 
	 
	
		| p-Value: | 
		0.388126 | 
	 
	
		| Z-Factor: | 
		-2.64753 | 
	 
	
		| Fitness Defect: | 
		0.9464 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.20 Celcius |  | Date: | 2006-02-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.04±0.00177 |  | Plate DMSO Control (-): | 0.65785±0.06406 |  | Plate Z-Factor: | 0.7682 |  
  |  png ps pdf |  
 
 
	
		| 2754269 | 
		methyl (4S)-4-[(3R,5R,10S,12S,13R,17R)-3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetrad ecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate | 
	 
	
		| 2755046 | 
		(3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoic acid | 
	 
	
		| 2755048 | 
		methyl (3S)-5-[(1R,2R,8aR)-2-acetyloxy-2,5,5,8a-tetramethyl-decalin-1-yl]-3-methyl-pentanoate | 
	 
	
		| 2825516 | 
		(10,13-dimethyl-1-oxo-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate | 
	 
	
		| 2825571 | 
		1-[(5S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17 -yl]ethyl acetate | 
	 
	
		| 3022911 | 
		ethyl 8-acetyloxyoctanoate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |