Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
PEX11 |
Replicates: |
2 |
Raw OD Value: r im |
0.6828±0.00643467 |
Normalized OD Score: sc h |
0.9795±0.0109119 |
Z-Score: |
-1.1721±0.535577 |
p-Value: |
0.274246 |
Z-Factor: |
-18.781 |
Fitness Defect: |
1.2937 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.10 Celcius | Date: | 2007-10-23 YYYY-MM-DD | Plate CH Control (+): | 0.039075±0.00043 | Plate DMSO Control (-): | 0.6854±0.12010 | Plate Z-Factor: | 0.3544 |
| png ps pdf |
2748236 |
[(7R)-7,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-1 7-yl] acetate |
2752319 |
methyl (1S,2R,6aR,6aS,6bR,8aS,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13, 14,14a,14b-hexadecahydro-1H-picene-4a-carboxylate |
2752320 |
(1S,2R,6aR,6aS,6bR,8aS,12aS)-10-acetyloxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13, 14,14a,14b-hexadecahydro-1H-picene-4a-carboxylic acid |
2754109 |
2-[(5S,10S,13S,17S)-17-acetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cycl openta[a]phenanthren-3-yl]acetic acid |
2754129 |
[(3R,5S,10S,13S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a] phenanthren-3-yl] acetate |
2754153 |
[(3S,5S,10S,13S)-3-ethyl-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a] phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|