Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
CLA4 |
Replicates: |
2 |
Raw OD Value: r im |
0.6802±0.0019799 |
Normalized OD Score: sc h |
0.9920±0.0077458 |
Z-Score: |
-0.3610±0.355205 |
p-Value: |
0.726508 |
Z-Factor: |
-1327.38 |
Fitness Defect: |
0.3195 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2007-09-12 YYYY-MM-DD | Plate CH Control (+): | 0.040499999999999994±0.00043 | Plate DMSO Control (-): | 0.66825±0.03252 | Plate Z-Factor: | 0.8394 |
| png ps pdf |
196290 |
[(3R,4aS,6aR,6aR,6bR,8aR,9R,12aR,14aS,14bS)-2,2,4a,6a,6a,8a,9,14a-octamethyl-10-oxo-3,4,5,6,6b,7,8,9,11, 12,12a,13,14,14b-tetradecahydro-1H-picen-3-yl] acetate |
222098 |
tert-butyl 12-acetyloxyoctadecanoate |
222827 |
[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-17-[(2R)-4-oxobutan-2-yl]-2,3,4,5,6,7,8,9, 11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-12-yl] acetate |
224447 |
[(5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclope nta[a]phenanthren-17-yl] acetate |
227113 |
[(3S,5S,8R,9S,10S,13R,14S,17S)-17-acetyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro -1H-cyclopenta[a]phenanthren-3-yl] acetate |
242132 |
[(5S,8R,9S,10S,13S,14S,17S)-13-methyl-3-oxo-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclope nta[a]phenanthren-17-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|