| Compound Information | SONAR Target prediction |  | Name: | OLEANANOIC ACID ACETATE |  | Unique Identifier: | SPE00240871  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H52O4 |  | Molecular Weight: | 448.34 g/mol |  | X log p: | 0.014  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 43.37 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C |  | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum |  | Reference: | Phytochemistry 18: 1375 (1979) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		LCB3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8092±0.00636396 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9944±0.00333006 | 
	 
	
		| Z-Score: | 
		-0.3124±0.190511 | 
	 
	
		| p-Value: | 
		0.756902 | 
	 
	
		| Z-Factor: | 
		-18.2018 | 
	 
	
		| Fitness Defect: | 
		0.2785 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.10 Celcius |  | Date: | 2006-03-31 YYYY-MM-DD |  | Plate CH Control (+): | 0.039474999999999996±0.00200 |  | Plate DMSO Control (-): | 0.793675±0.01024 |  | Plate Z-Factor: | 0.9575 |  
  |  png ps pdf |  
 
 
	
		| 631371 | 
		(4,4,6a,8a,11,12,14b-heptamethyl-13-oxo-2,3,4a,5,6,6a,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-pice n-3-yl) acetate | 
	 
	
		| 631387 | 
		(4,4,6a,8a,11,11,14b-heptamethyl-13-oxo-1,2,3,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicen-3-y l) acetate | 
	 
	
		| 632027 | 
		4-(3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoic acid | 
	 
	
		| 632279 | 
		(4,4,10,13-tetramethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl ) acetate | 
	 
	
		| 632419 | 
		methyl 10-acetyloxy-2,2,4a,6a,8a,9,14a-heptamethyl-1,3,4,5,6,6b,7,8,9,10,11,12,12a,13,14,14b-hexadecahydropicen e-6a-carboxylate | 
	 
	
		| 633420 | 
		[10,13-dimethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopent a[a]phenanthren-3-yl] acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 10 | 1 2 Next >>  |   
 |  active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |