Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
BY4741-3rd |
Replicates: |
2 |
Raw OD Value: r im |
0.6734±0.00558614 |
Normalized OD Score: sc h |
1.0076±0.0266293 |
Z-Score: |
0.2776±1.05536 |
p-Value: |
0.47261 |
Z-Factor: |
-8.26741 |
Fitness Defect: |
0.7495 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2007-09-25 YYYY-MM-DD | Plate CH Control (+): | 0.039625±0.00079 | Plate DMSO Control (-): | 0.659925±0.13285 | Plate Z-Factor: | 0.2757 |
| png ps pdf |
631371 |
(4,4,6a,8a,11,12,14b-heptamethyl-13-oxo-2,3,4a,5,6,6a,6b,7,8,9,10,11,12,12a,14,14a-hexadecahydro-1H-pice n-3-yl) acetate |
631387 |
(4,4,6a,8a,11,11,14b-heptamethyl-13-oxo-1,2,3,4a,5,6,6a,6b,7,8,9,10,12,12a,14,14a-hexadecahydropicen-3-y l) acetate |
632027 |
4-(3,12-diacetyloxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phen anthren-17-yl)pentanoic acid |
632279 |
(4,4,10,13-tetramethyl-3-oxo-2,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl ) acetate |
632419 |
methyl 10-acetyloxy-2,2,4a,6a,8a,9,14a-heptamethyl-1,3,4,5,6,6b,7,8,9,10,11,12,12a,13,14,14b-hexadecahydropicen e-6a-carboxylate |
633420 |
[10,13-dimethyl-17-(6-methylheptan-2-yl)-11-oxo-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahydrocyclopent a[a]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|