| Compound Information | SONAR Target prediction | | Name: | OLEANANOIC ACID ACETATE | | Unique Identifier: | SPE00240871 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H52O4 | | Molecular Weight: | 448.34 g/mol | | X log p: | 0.014 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | | Reference: | Phytochemistry 18: 1375 (1979) |
| Species: |
4932 |
| Condition: |
TEP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6665±0.0265165 |
| Normalized OD Score: sc h |
0.9871±0.0112092 |
| Z-Score: |
-0.3348±0.278294 |
| p-Value: |
0.74259 |
| Z-Factor: |
-6.85936 |
| Fitness Defect: |
0.2976 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|H6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2005-12-23 YYYY-MM-DD | | Plate CH Control (+): | 0.038975±0.00370 | | Plate DMSO Control (-): | 0.6473±0.01825 | | Plate Z-Factor: | 0.9157 |
| png ps pdf |
| 565841 |
n/a |
| 566445 |
n/a |
| 566446 |
n/a |
| 574191 |
n/a |
| 579172 |
(10,13-dimethyl-2-oxo-1,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
| 579601 |
methyl 5-(6-acetyloxy-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl)-3-methyl-pentanoate |
| internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
| active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|