Compound Information | SONAR Target prediction | Name: | OLEANANOIC ACID ACETATE | Unique Identifier: | SPE00240871 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H52O4 | Molecular Weight: | 448.34 g/mol | X log p: | 0.014 (online calculus) | Lipinksi Failures | 0 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CC(=O)OC1CCC2(C)C(CCC3(C)C2CCC2C4CC(C)(C)CCC4(CCC23C)C(O)=O)C1(C)C | Source: | ex Machaerium kuhlmannii and Helichrysum chrysargyrum | Reference: | Phytochemistry 18: 1375 (1979) |
Species: |
4932 |
Condition: |
DEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7191±0.00961665 |
Normalized OD Score: sc h |
0.9998±0.000152088 |
Z-Score: |
-0.0090±0.00765834 |
p-Value: |
0.992804 |
Z-Factor: |
-14.2158 |
Fitness Defect: |
0.0072 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2005-12-22 YYYY-MM-DD | Plate CH Control (+): | 0.039025000000000004±0.00098 | Plate DMSO Control (-): | 0.687775±0.01699 | Plate Z-Factor: | 0.9114 |
| png ps pdf |
537925 |
methyl 11-acetyloxyhexadecanoate |
537935 |
methyl 15-acetyloxyhexadecanoate |
537951 |
methyl 10-acetyloxyhexadecanoate |
538065 |
(2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl) acetate |
538071 |
methyl 4-(3-acetyloxy-10-methyl-12-oxo-2,3,4,5,6,7,8,9,11,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenant hren-17-yl)pentanoate |
538122 |
[10,13-dimethyl-12-oxo-17-(5-oxopentan-2-yl)-1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-yl] acetate |
internal high similarity DBLink | Rows returned: 10 | 1 2 Next >> |
active | Cluster 9057 | Additional Members: 1 | Rows returned: 0 | |
|