| Compound Information | SONAR Target prediction | | Name: | 3,4-DIMETHOXYDALBERGIONE | | Unique Identifier: | SPE00240828 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 268.18 g/mol | | X log p: | 14.879 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 52.6 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1c(=O)cc(C(C=C)c2ccccc2)c(=O)c1OC | | Class: | quinone | | Source: | Dalbergia spp, Machaerium spp | | Reference: | Tetrahedron 21: 2697 (9165) | | Therapeutics: | induces dermatitis |
| Species: |
4932 |
| Condition: |
GSY2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3711±0.0145664 |
| Normalized OD Score: sc h |
0.5613±0.0201166 |
| Z-Score: |
-20.5788±0.732095 |
| p-Value: |
0 |
| Z-Factor: |
0.558672 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 13|B3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.10 Celcius | | Date: | 2008-04-30 YYYY-MM-DD | | Plate CH Control (+): | 0.040374999999999994±0.00173 | | Plate DMSO Control (-): | 0.660175±0.02969 | | Plate Z-Factor: | 0.8505 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 115019 |
2,3-dimethoxy-5-[(1R)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 9726 | Additional Members: 2 | Rows returned: 1 | |
|