| 
 | Compound Information | SONAR Target prediction |  | Name: | 3,4-DIMETHOXYDALBERGIONE |  | Unique Identifier: | SPE00240828 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 268.18 g/mol |  | X log p: | 14.879  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 52.6 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COc1c(=O)cc(C(C=C)c2ccccc2)c(=O)c1OC |  | Class: | quinone |  | Source: | Dalbergia spp, Machaerium spp |  | Reference: | Tetrahedron 21: 2697 (9165) |  | Therapeutics: | induces dermatitis | 
 
 
	
		| Species: | 4932 |  
		| Condition: | YPT6 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.0675±0.00615183 |  
		| Normalized OD Score: sc h | 0.1099±0.00913278 |  
		| Z-Score: | -29.9121±1.16639 |  
		| p-Value: | 0 |  
		| Z-Factor: | 0.781905 |  
		| Fitness Defect: | INF |  
		| Bioactivity Statement: | Toxic |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 4|H4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.90 Celcius |  | Date: | 2006-02-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.041425000000000003±0.00104 |  | Plate DMSO Control (-): | 0.6384000000000001±0.03634 |  | Plate Z-Factor: | 0.9350 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 115019 | 2,3-dimethoxy-5-[(1R)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | nonactive | Cluster 9726 | Additional Members: 2 | Rows returned: 1 |  | 
 
 |