Compound Information | SONAR Target prediction | Name: | 3,4-DIMETHOXYDALBERGIONE | Unique Identifier: | SPE00240828 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 268.18 g/mol | X log p: | 14.879 (online calculus) | Lipinksi Failures | 1 | TPSA | 52.6 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1c(=O)cc(C(C=C)c2ccccc2)c(=O)c1OC | Class: | quinone | Source: | Dalbergia spp, Machaerium spp | Reference: | Tetrahedron 21: 2697 (9165) | Therapeutics: | induces dermatitis |
Species: |
4932 |
Condition: |
RIC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.1246±0.0059397 |
Normalized OD Score: sc h |
0.3610±0.00919987 |
Z-Score: |
-7.8531±1.2936 |
p-Value: |
0.00000000000198267 |
Z-Factor: |
0.705129 |
Fitness Defect: |
26.9466 |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2006-03-17 YYYY-MM-DD | Plate CH Control (+): | 0.0394±0.00153 | Plate DMSO Control (-): | 0.39115±0.02099 | Plate Z-Factor: | 0.8454 |
| png ps pdf |
DBLink | Rows returned: 1 | |
115019 |
2,3-dimethoxy-5-[(1R)-1-phenylprop-2-enyl]cyclohexa-2,5-diene-1,4-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 9726 | Additional Members: 2 | Rows returned: 1 | |
|