| Compound Information | SONAR Target prediction |
| Name: | RETUSIN 7-METHYL ETHER |
| Unique Identifier: | SPE00240645 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 284.179 g/mol |
| X log p: | 15.443 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 44.76 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | COc1ccc(cc1)C1=COc2c(O)c(OC)ccc2C1=O |
| Class: | isoflavone |
| Source: | derivative Dalbergia spp |
| Found: 76 active | as graph: single | with analogs | [1] << Back 51 52 53 54 55 56 57 58 59 60 Next >> [76] |
| Species: | 4932 |
| Condition: | LAT1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.3818±0.0236881 |
| Normalized OD Score: sc h | 0.5709±0.0324076 |
| Z-Score: | -21.0887±0.242838 |
| p-Value: | 0 |
| Z-Factor: | 0.672958 |
| Fitness Defect: | INF |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 6710639 | 8-hydroxy-7-methoxy-3-(4-methoxyphenyl)chromen-4-one |
| internal high similarity DBLink | Rows returned: 14 | << Back 1 2 3 |
| SPE00201185 | 0.9407 |
| SPE00201312 | 0.9481 |
| active | Cluster 5360 | Additional Members: 5 | Rows returned: 3 |
| SPE00200139 | 0.440677966101695 |
| SPE00201185 | 0.307692307692308 |
| SPE00201312 | 0 |
Service provided by the
Mike Tyers Laboratory