| Compound Information | SONAR Target prediction |
| Name: | 5,7-DIHYDROXYISOFLAVONE |
| Unique Identifier: | SPE00240565 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 244.158 g/mol |
| X log p: | 16.755 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 4 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | Oc1cc(O)c2C(=O)C(=COc2c1)c1ccccc1 |
| Class: | isoflavone |
| Source: | Arachis hypogaea & Derris spp |
| Reference: | J Chem Soc 1953:1852; CA 104:165440 (1986) |
| Found: 85 active | as graph: single | with analogs | [1] << Back 31 32 33 34 35 36 37 38 39 40 Next >> [85] |
| Species: | 4932 |
| Condition: | MDH1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6248±0.0700036 |
| Normalized OD Score: sc h | 0.7991±0.072734 |
| Z-Score: | -11.7776±5.5038 |
| p-Value: | 0.00000000000000156291 |
| Z-Factor: | -2.40535 |
| Fitness Defect: | 34.0922 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 5377381 | 5,7-dihydroxy-3-phenyl-chromen-4-one |
| internal high similarity DBLink | Rows returned: 17 | 1 2 3 Next >> |
| SPE00201182 | 0.9008 |
| SPE00201310 | 0.9063 |
| SPE00211076 | 0.9077 |
| SPE00201355 | 0.9147 |
| SPE00201309 | 0.9206 |
| BTB 12551 | 0.9250 |
| active | Cluster 14679 | Additional Members: 9 | Rows returned: 4 |
| SPE01500726 | 0.362068965517241 |
| SPE00210296 | 0.269230769230769 |
| SPE10100004 | 0.245283018867924 |
| SPE10100003 | 0 |
Service provided by the
Mike Tyers Laboratory