Compound Information | SONAR Target prediction | Name: | DIHYDROLANOSTEROL | Unique Identifier: | SPE00240449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O | Molecular Weight: | 376.32 g/mol | X log p: | 0.339 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Reference: | J Chem Soc 1951: 3147 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
KAR3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6233±0.00784888 |
Normalized OD Score: sc h |
0.9925±0.0000270474 |
Z-Score: |
-0.3488±0.0108923 |
p-Value: |
0.727238 |
Z-Factor: |
-16.2509 |
Fitness Defect: |
0.3185 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.50 Celcius | Date: | 2007-09-06 YYYY-MM-DD | Plate CH Control (+): | 0.042175000000000004±0.00103 | Plate DMSO Control (-): | 0.6192±0.10953 | Plate Z-Factor: | 0.3962 |
| png ps pdf |
7002251 |
(3R,4S,5S,9R,10R,13S,14S,17S)-4,10,13-trimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,1 2,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7002768 |
(3R,4aS,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
7002769 |
(3R,4aR,6aR,6bR,8aS,12aR,14bS)-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetr adecahydropicen-3-ol |
7003886 |
(3S,5R,10S,13S,14S,17R)-17-[(2S)-hex-5-en-2-yl]-4,4,10,14-tetramethyl-1,2,3,5,6,7,11,12,13,15,16,17-dode cahydrocyclopenta[a]phenanthren-3-ol |
7060882 |
(3S,5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
7091807 |
(3S,4R,5S,9S,10R,13S,14R,17R)-4,10,13-trimethyl-17-[(Z,2R)-5-propan-2-ylhept-5-en-2-yl]-2,3,4,5,6,9,11,1 2,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|