| Compound Information | SONAR Target prediction | | Name: | DIHYDROLANOSTEROL | | Unique Identifier: | SPE00240449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O | | Molecular Weight: | 376.32 g/mol | | X log p: | 0.339 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Reference: | J Chem Soc 1951: 3147 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
ARP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6977±0.00707107 |
| Normalized OD Score: sc h |
1.0009±0.00517217 |
| Z-Score: |
0.0377±0.257335 |
| p-Value: |
0.855714 |
| Z-Factor: |
-712.787 |
| Fitness Defect: |
0.1558 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2006-03-23 YYYY-MM-DD | | Plate CH Control (+): | 0.04085±0.00154 | | Plate DMSO Control (-): | 0.6854500000000001±0.00955 | | Plate Z-Factor: | 0.9493 |
| png ps pdf |
| 6575436 |
(3S,5R,10R,13R,14S,17R)-17-[(2S)-hex-5-en-2-yl]-4,4,10,14-tetramethyl-1,2,3,5,6,7,11,12,13,15,16,17-dode cahydrocyclopenta[a]phenanthren-3-ol |
| 6708537 |
(3S,10S,13R,14R)-4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H -cyclopenta[a]phenanthren-3-ol |
| 6708538 |
(3S,13S,14S,17S)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro -1H-cyclopenta[a]phenanthren-3-ol |
| 6708649 |
(13R,14R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyc lopenta[a]phenanthren-3-ol |
| 6710616 |
(3S,5S,10R,13S)-10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyc lopenta[a]phenanthren-3-ol |
| 6710749 |
(3S,13R,14R)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H- cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|