| Compound Information | SONAR Target prediction | | Name: | DIHYDROLANOSTEROL | | Unique Identifier: | SPE00240449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O | | Molecular Weight: | 376.32 g/mol | | X log p: | 0.339 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Reference: | J Chem Soc 1951: 3147 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
SER1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5395±0.0413657 |
| Normalized OD Score: sc h |
0.9319±0.0257943 |
| Z-Score: |
-2.1333±0.753965 |
| p-Value: |
0.0586086 |
| Z-Factor: |
-16.0723 |
| Fitness Defect: |
2.8369 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.10 Celcius | | Date: | 2007-09-17 YYYY-MM-DD | | Plate CH Control (+): | 0.039525000000000005±0.00046 | | Plate DMSO Control (-): | 0.5672250000000001±0.10392 | | Plate Z-Factor: | 0.3813 |
|  png
ps
pdf |
| 5318906 |
2-[(1R,8S)-1,8-dimethyl-1,2,3,4,6,7,8,8a-octahydronaphthalen-2-yl]propan-2-ol |
| 5319548 |
17-[(E)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen
ta[a]phenanthren-3-ol |
| 5319628 |
(3S,10R,13S,17R)-4,10,13-trimethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17
-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 5319640 |
(3S,10S,13R)-10,13,14-trimethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-1,2,3,4,5,6,7,8,12,15,16,17-dode
cahydrocyclopenta[a]phenanthren-3-ol |
| 5319641 |
(3S,10S,13R)-17-(5,6-dimethylheptan-2-yl)-10,13,14-trimethyl-1,2,3,4,5,6,7,8,12,15,16,17-dodecahydrocycl
openta[a]phenanthren-3-ol |
| 5319652 |
17-(5-ethyl-6-methyl-hept-5-en-2-yl)-4,10,13-trimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cycl
openta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|
