| Compound Information | SONAR Target prediction | | Name: | DIHYDROLANOSTEROL | | Unique Identifier: | SPE00240449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O | | Molecular Weight: | 376.32 g/mol | | X log p: | 0.339 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Reference: | J Chem Soc 1951: 3147 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
TEP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6705±0.027365 |
| Normalized OD Score: sc h |
1.0400±0.00532714 |
| Z-Score: |
1.0639±0.07718 |
| p-Value: |
0.288068 |
| Z-Factor: |
-2.97399 |
| Fitness Defect: |
1.2446 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2005-12-23 YYYY-MM-DD | | Plate CH Control (+): | 0.039875±0.00227 | | Plate DMSO Control (-): | 0.5946750000000001±0.02447 | | Plate Z-Factor: | 0.8345 |
|  png
ps
pdf |
| 5317337 |
n/a |
| 5317423 |
(3S,10R,13S,17R)-17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1
H-cyclopenta[a]phenanthren-3-ol |
| 5317775 |
2,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,10-diol |
| 5317959 |
n/a |
| 5318052 |
2-[(6S)-6,10-dimethyl-2-spiro[4.5]dec-9-enyl]propan-2-ol |
| 5318507 |
n/a |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|
