Compound Information | SONAR Target prediction | Name: | DIHYDROLANOSTEROL | Unique Identifier: | SPE00240449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O | Molecular Weight: | 376.32 g/mol | X log p: | 0.339 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Reference: | J Chem Soc 1951: 3147 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SET2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6882±0.0115258 |
Normalized OD Score: sc h |
0.9854±0.0134759 |
Z-Score: |
-0.8548±0.786274 |
p-Value: |
0.461688 |
Z-Factor: |
-34.6771 |
Fitness Defect: |
0.7729 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.90 Celcius | Date: | 2007-11-15 YYYY-MM-DD | Plate CH Control (+): | 0.041475±0.00094 | Plate DMSO Control (-): | 0.6941±0.12437 | Plate Z-Factor: | 0.4058 |
| png ps pdf |
5317337 |
n/a |
5317423 |
(3S,10R,13S,17R)-17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1 H-cyclopenta[a]phenanthren-3-ol |
5317775 |
2,2,4a,6a,6b,9,9,12a-octamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-3,10-diol |
5317959 |
n/a |
5318052 |
2-[(6S)-6,10-dimethyl-2-spiro[4.5]dec-9-enyl]propan-2-ol |
5318507 |
n/a |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|