Compound Information | SONAR Target prediction | Name: | DIHYDROLANOSTEROL | Unique Identifier: | SPE00240449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O | Molecular Weight: | 376.32 g/mol | X log p: | 0.339 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Reference: | J Chem Soc 1951: 3147 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
FUR4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4259±0.0185969 |
Normalized OD Score: sc h |
0.9591±0.0223942 |
Z-Score: |
-1.0290±0.399412 |
p-Value: |
0.322498 |
Z-Factor: |
-2.3924 |
Fitness Defect: |
1.1317 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.60 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.039975±0.03650 | Plate DMSO Control (-): | 0.44737499999999997±0.00992 | Plate Z-Factor: | 0.3234 |
| png ps pdf |
5316994 |
(3S,10S,13R,17R)-4,4,10,13,14-pentamethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,5,6,7,11,12,15,16, 17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
5317118 |
n/a |
5317269 |
2-[(2R,4aS)-4a,8-dimethyl-2,3,4,5,6,8a-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
5317296 |
(3S,10S,14S)-4,4,10,13,14-pentamethyl-17-(6-methylhept-5-en-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H- cyclopenta[a]phenanthren-3-ol |
5317299 |
(3S,10S,14S)-4,4,10,13,14-pentamethyl-17-[(2S)-6-methyl-5-methylidene-heptan-2-yl]-2,3,5,6,7,11,12,15,16 ,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
5317314 |
(3S,6aR,6aR,8aS,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-2,3,4a,5,6,6a,7,8,9,12,12a,13,14,14a-tetradecahydr o-1H-picene-3,13-diol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|