Compound Information | SONAR Target prediction | Name: | DIHYDROLANOSTEROL | Unique Identifier: | SPE00240449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O | Molecular Weight: | 376.32 g/mol | X log p: | 0.339 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Reference: | J Chem Soc 1951: 3147 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ROM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6545±0.00784888 |
Normalized OD Score: sc h |
0.9797±0.00200815 |
Z-Score: |
-0.8972±0.119155 |
p-Value: |
0.371284 |
Z-Factor: |
-41.5424 |
Fitness Defect: |
0.9908 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2007-11-21 YYYY-MM-DD | Plate CH Control (+): | 0.041025±0.00041 | Plate DMSO Control (-): | 0.644675±0.11629 | Plate Z-Factor: | 0.3965 |
| png ps pdf |
3083379 |
n/a |
3084367 |
(3S,4aS,6aS,6bS,8aR,11R,12S,12aR,14bS)-4,4,6a,6b,8a,11,12,14b-octamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,1 3,14-tetradecahydro-1H-picen-3-ol |
3312783 |
4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,13,14-tetradecahydropicen-3-ol |
3375145 |
10,13-dimethyl-17-(6-methyl-5-methylidene-heptan-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cycl openta[a]phenanthren-3-ol |
3710743 |
17-hex-5-en-2-yl-4,4,10,14-tetramethyl-1,2,3,5,6,7,11,12,13,15,16,17-dodecahydrocyclopenta[a]phenanthren -3-ol |
4227079 |
1,1,4a-trimethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|