| Compound Information | SONAR Target prediction | | Name: | DIHYDROLANOSTEROL | | Unique Identifier: | SPE00240449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O | | Molecular Weight: | 376.32 g/mol | | X log p: | 0.339 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Reference: | J Chem Soc 1951: 3147 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
NBP2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7459±0.00424264 |
| Normalized OD Score: sc h |
1.0243±0.0033658 |
| Z-Score: |
0.6008±0.0169748 |
| p-Value: |
0.547984 |
| Z-Factor: |
-3.72936 |
| Fitness Defect: |
0.6015 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2006-02-17 YYYY-MM-DD | | Plate CH Control (+): | 0.038325±0.00486 | | Plate DMSO Control (-): | 0.691525±0.03422 | | Plate Z-Factor: | 0.7953 |
|  png
ps
pdf |
| 556577 |
2,3,3a,4,7,7a-hexahydro-1H-inden-2-ol |
| 565337 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[
a]phenanthren-3-ol |
| 577203 |
n/a |
| 578322 |
n/a |
| 584538 |
2,2,10,13-tetramethyl-17-(6-methylheptan-2-yl)-1,3,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phe
nanthren-3-ol |
| 585856 |
1,1,4a,7,7-pentamethyl-3,4,4b,5,6,8,10,10a-octahydro-2H-phenanthren-2-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|
