Compound Information | SONAR Target prediction | Name: | DIHYDROLANOSTEROL | Unique Identifier: | SPE00240449 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H52O | Molecular Weight: | 376.32 g/mol | X log p: | 0.339 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | Source: | ex wool fat of sheep | Reference: | J Chem Soc 1951: 3147 | Generic_name: | LANOSTEROL | Chemical_iupac_name: | LANOSTEROL | Drug_type: | Experimental | Kegg_compound_id: | C01724 | Drugbank_id: | EXPT02002 | Logp: | 7.63 | Cas_registry_number: | 79-63-0 | Drug_category: | Lanosterol Synthase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
IRE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6775±0.00827315 |
Normalized OD Score: sc h |
0.9817±0.00827503 |
Z-Score: |
-0.9784±0.414652 |
p-Value: |
0.348342 |
Z-Factor: |
-40.9578 |
Fitness Defect: |
1.0546 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 24|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.00 Celcius | Date: | 2007-11-23 YYYY-MM-DD | Plate CH Control (+): | 0.040075±0.00062 | Plate DMSO Control (-): | 0.69245±0.12470 | Plate Z-Factor: | 0.4034 |
| png ps pdf |
521229 |
17-(5-ethyl-6-methyl-hept-3-en-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclope nta[a]phenanthren-3-ol |
521367 |
17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta [a]phenanthren-3-ol |
534942 |
4,10,13-trimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a] phenanthren-3-ol |
535272 |
4-(2,6,6-trimethyl-1-cyclohexenyl)butan-1-ol |
536989 |
10,13,14-trimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,6,7,11,12,15,16,17-dodecahydrocyclopenta[a]phenant hren-3-ol |
537069 |
4,4,10,13,14-pentamethyl-17-(6-methylheptan-2-yl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phe nanthren-3-ol |
internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|