| Compound Information | SONAR Target prediction | | Name: | DIHYDROLANOSTEROL | | Unique Identifier: | SPE00240449 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C30H52O | | Molecular Weight: | 376.32 g/mol | | X log p: | 0.339 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)CCCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O)CCC4(C)C=3CCC12C | | Source: | ex wool fat of sheep | | Reference: | J Chem Soc 1951: 3147 | | Generic_name: | LANOSTEROL | | Chemical_iupac_name: | LANOSTEROL | | Drug_type: | Experimental | | Kegg_compound_id: | C01724 | | Drugbank_id: | EXPT02002 | | Logp: | 7.63 | | Cas_registry_number: | 79-63-0 | | Drug_category: | Lanosterol Synthase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
RPN10 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6838±0.0125158 |
| Normalized OD Score: sc h |
0.9812±0.00966646 |
| Z-Score: |
-0.9493±0.475639 |
| p-Value: |
0.369244 |
| Z-Factor: |
-36.7127 |
| Fitness Defect: |
0.9963 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 24|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.50 Celcius | | Date: | 2007-09-28 YYYY-MM-DD | | Plate CH Control (+): | 0.04202499999999999±0.00309 | | Plate DMSO Control (-): | 0.68675±0.12256 | | Plate Z-Factor: | 0.3801 |
| png ps pdf |
| 390622 |
(3S,4S,10S,13R,14R,17R)-4,10,13,14-tetramethyl-17-[(2R)-6-methyl-5-methylidene-heptan-2-yl]-1,2,3,4,5,6, 7,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 428925 |
n/a |
| 440371 |
(3S,5S,10S,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-5-methylidene-heptan-2-yl]-2,3,4,5,6,7,11,12,14 ,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 440375 |
(3S,5S,10S,13S,14R,17R)-4,4,10,13-tetramethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,9,11,12,14,15,16,1 7-dodecahydrocyclopenta[a]phenanthren-3-ol |
| 440556 |
(4S,5S)-4,10,13-trimethyl-17-(6-methylhept-5-en-2-yl)-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclo penta[a]phenanthren-3-ol |
| 440557 |
(3S,9R,10R,13S,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-do decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| internal high similarity DBLink | Rows returned: 11 | 1 2 Next >> |
| active | Cluster 1278 | Additional Members: 6 | Rows returned: 3 | |
|