| Compound Information | SONAR Target prediction | | Name: | ONONETIN | | Unique Identifier: | SPE00212097 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 15.172 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1 | | Class: | aromatic | | Source: | Trifolium subterraneum | | Reference: | Monatsh Chem 63: 201 (1933); Aust J Chem 19: 1755 (1966) |
| Species: |
4932 |
| Condition: |
SPT3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2199±0.0439113 |
| Normalized OD Score: sc h |
0.4554±0.0627754 |
| Z-Score: |
-8.8569±0.736592 |
| p-Value: |
3.84086e-17 |
| Z-Factor: |
0.429151 |
| Fitness Defect: |
37.7983 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 14|C6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2008-02-13 YYYY-MM-DD | | Plate CH Control (+): | 0.040975±0.00162 | | Plate DMSO Control (-): | 0.46367500000000006±0.01906 | | Plate Z-Factor: | 0.8492 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 253300 |
2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| 259632 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|
