| Compound Information | SONAR Target prediction | | Name: | ONONETIN | | Unique Identifier: | SPE00212097 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 15.172 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1 | | Class: | aromatic | | Source: | Trifolium subterraneum | | Reference: | Monatsh Chem 63: 201 (1933); Aust J Chem 19: 1755 (1966) |
| Species: |
4932 |
| Condition: |
MCM21 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5937±0.00806102 |
| Normalized OD Score: sc h |
0.9118±0.00777369 |
| Z-Score: |
-4.3191±0.150136 |
| p-Value: |
0.0000174194 |
| Z-Factor: |
-0.649772 |
| Fitness Defect: |
10.9579 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|D10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2007-11-07 YYYY-MM-DD | | Plate CH Control (+): | 0.040925±0.00077 | | Plate DMSO Control (-): | 0.647575±0.02404 | | Plate Z-Factor: | 0.8735 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 253300 |
2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| 259632 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 3 | |
|
