Compound Information | SONAR Target prediction | Name: | ONONETIN | Unique Identifier: | SPE00212097 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 244.158 g/mol | X log p: | 15.172 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1 | Class: | aromatic | Source: | Trifolium subterraneum | Reference: | Monatsh Chem 63: 201 (1933); Aust J Chem 19: 1755 (1966) |
Species: |
4932 |
Condition: |
SPE00200002 |
Replicates: |
2 |
Raw OD Value: r im |
0.6446±0.0136472 |
Normalized OD Score: sc h |
1.0072±0.0108191 |
Z-Score: |
0.3091±0.467881 |
p-Value: |
0.752432 |
Z-Factor: |
-40.1107 |
Fitness Defect: |
0.2844 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 1|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.00 Celcius | Date: | 2006-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.03965±0.00149 | Plate DMSO Control (-): | 0.6285499999999999±0.02278 | Plate Z-Factor: | 0.8820 |
| png ps pdf |
DBLink | Rows returned: 2 | |
253300 |
2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
259632 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|