| Compound Information | SONAR Target prediction | | Name: | ONONETIN | | Unique Identifier: | SPE00212097 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 244.158 g/mol | | X log p: | 15.172 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1 | | Class: | aromatic | | Source: | Trifolium subterraneum | | Reference: | Monatsh Chem 63: 201 (1933); Aust J Chem 19: 1755 (1966) |
| Species: |
4932 |
| Condition: |
SPE01500767 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7014±0 |
| Normalized OD Score: sc h |
1.0063±0 |
| Z-Score: |
0.0950±0 |
| p-Value: |
0.92432 |
| Z-Factor: |
-10.8091 |
| Fitness Defect: |
0.0787 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SpectrumTMP | | Plate Number and Position: | 1|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2006-08-13 YYYY-MM-DD | | Plate CH Control (+): | 0.03995±0.00039 | | Plate DMSO Control (-): | 0.72925±0.01850 | | Plate Z-Factor: | 0.9178 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 253300 |
2-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| 259632 |
1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|
