| 
 | Compound Information | SONAR Target prediction |  | Name: | DIHYDRO-beta-TUBAIC ACID |  | Unique Identifier: | SPE00211531 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C13H16O4 |  | Molecular Weight: | 220.137 g/mol |  | X log p: | 3.884  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | COc1c2CCC(C)(C)Oc2ccc1C(O)=O |  | Source: | derivative ex mundulone | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SPE00201081 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.5944±0.00487904 |  
		| Normalized OD Score: sc h | 1.0116±0.0077998 |  
		| Z-Score: | 0.3916±0.257684 |  
		| p-Value: | 0.700138 |  
		| Z-Factor: | -63.9504 |  
		| Fitness Defect: | 0.3565 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 21.50 Celcius |  | Date: | 2006-12-15 YYYY-MM-DD |  | Plate CH Control (+): | 0.039425±0.00176 |  | Plate DMSO Control (-): | 0.5737±0.02520 |  | Plate Z-Factor: | 0.8482 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 1 |  | 
 
	
		| 3548249 | 5-methoxy-2,2-dimethyl-chroman-6-carboxylic acid |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 8617 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |