Compound Information | SONAR Target prediction | Name: | DIHYDRO-beta-TUBAIC ACID | Unique Identifier: | SPE00211531 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C13H16O4 | Molecular Weight: | 220.137 g/mol | X log p: | 3.884 (online calculus) | Lipinksi Failures | 0 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | COc1c2CCC(C)(C)Oc2ccc1C(O)=O | Source: | derivative ex mundulone |
Species: |
4932 |
Condition: |
NBP2 |
Replicates: |
2 |
Raw OD Value: r im |
0.8095±0.0111723 |
Normalized OD Score: sc h |
1.0504±0.0340024 |
Z-Score: |
1.1894±0.640276 |
p-Value: |
0.280932 |
Z-Factor: |
-3.0402 |
Fitness Defect: |
1.2696 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|F8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.40 Celcius | Date: | 2006-02-17 YYYY-MM-DD | Plate CH Control (+): | 0.03835±0.00143 | Plate DMSO Control (-): | 0.7697499999999999±0.01963 | Plate Z-Factor: | 0.9337 |
| png ps pdf |
DBLink | Rows returned: 1 | |
3548249 |
5-methoxy-2,2-dimethyl-chroman-6-carboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 8617 | Additional Members: 1 | Rows returned: 0 | |
|