| Compound Information | SONAR Target prediction |  | Name: | DIHYDRO-beta-TUBAIC ACID |  | Unique Identifier: | SPE00211531  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C13H16O4 |  | Molecular Weight: | 220.137 g/mol |  | X log p: | 3.884  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 35.53 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | COc1c2CCC(C)(C)Oc2ccc1C(O)=O |  | Source: | derivative ex mundulone |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SPE00211531 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5197±0.0118087 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0266±0.00080029 | 
	 
	
		| Z-Score: | 
		0.5398±0.0818212 | 
	 
	
		| p-Value: | 
		0.589988 | 
	 
	
		| Z-Factor: | 
		-3.12588 | 
	 
	
		| Fitness Defect: | 
		0.5277 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SpectrumTMP |  | Plate Number and Position: | 1|E5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.00 Celcius |  | Date: | 2006-12-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.039275±0.00247 |  | Plate DMSO Control (-): | 0.536475±0.01697 |  | Plate Z-Factor: | 0.8737 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 3548249 | 
		5-methoxy-2,2-dimethyl-chroman-6-carboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 8617 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |