Compound Information | SONAR Target prediction | Name: | DANTHRON | Unique Identifier: | SPE00211468 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 11.828 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | Oc1cccc2c(=O)c3cccc(O)c3c(=O)c12 | Class: | quinone | Source: | Rheum palmatum, Xyris semifuscata | Reference: | JACS 53: 4112 (1931) | Therapeutics: | cathartic |
Species: |
4932 |
Condition: |
PPZ1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6671±0.0243952 |
Normalized OD Score: sc h |
0.8197±0.0258281 |
Z-Score: |
-9.1026±1.02396 |
p-Value: |
2.67842e-17 |
Z-Factor: |
0.314278 |
Fitness Defect: |
38.1587 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2006-05-17 YYYY-MM-DD | Plate CH Control (+): | 0.03805±0.00203 | Plate DMSO Control (-): | 0.79965±0.01247 | Plate Z-Factor: | 0.9295 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2950 |
1,8-dihydroxyanthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 | |
|