Compound Information | SONAR Target prediction | Name: | DANTHRON | Unique Identifier: | SPE00211468 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 11.828 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | Oc1cccc2c(=O)c3cccc(O)c3c(=O)c12 | Class: | quinone | Source: | Rheum palmatum, Xyris semifuscata | Reference: | JACS 53: 4112 (1931) | Therapeutics: | cathartic |
Species: |
4896 |
Condition: |
MT1181-W303mata |
Replicates: |
2 |
Raw OD Value: r im |
0.2176±0.0144957 |
Normalized OD Score: sc h |
0.5705±0.0379122 |
Z-Score: |
-4.3694±0.349158 |
p-Value: |
0.0000206948 |
Z-Factor: |
0.128975 |
Fitness Defect: |
10.7856 |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|A3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2005-12-14 YYYY-MM-DD | Plate CH Control (+): | 0.442±0.01796 | Plate DMSO Control (-): | 0.38835±0.03811 | Plate Z-Factor: | -2.1178 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2950 |
1,8-dihydroxyanthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 7565 | Additional Members: 10 | Rows returned: 5 | |
|