Compound Information | SONAR Target prediction | Name: | DANTHRON | Unique Identifier: | SPE00211468 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 232.147 g/mol | X log p: | 11.828 (online calculus) | Lipinksi Failures | 1 | TPSA | 34.14 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 0 | Canonical Smiles: | Oc1cccc2c(=O)c3cccc(O)c3c(=O)c12 | Class: | quinone | Source: | Rheum palmatum, Xyris semifuscata | Reference: | JACS 53: 4112 (1931) | Therapeutics: | cathartic |
Species: |
4932 |
Condition: |
DCC1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5222±0.0329512 |
Normalized OD Score: sc h |
0.7701±0.0455954 |
Z-Score: |
-10.5363±1.8202 |
p-Value: |
1.13057e-20 |
Z-Factor: |
0.160248 |
Fitness Defect: |
45.929 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 25|H11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.70 Celcius | Date: | 2008-06-25 YYYY-MM-DD | Plate CH Control (+): | 0.040675±0.00108 | Plate DMSO Control (-): | 0.6653±0.01214 | Plate Z-Factor: | 0.9248 |
| png ps pdf |
DBLink | Rows returned: 1 | |
2950 |
1,8-dihydroxyanthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 7565 | Additional Members: 10 | Rows returned: 6 | |
|