Compound Information | SONAR Target prediction | Name: | 5,4`-DIMETHOXYFLAVONE | Unique Identifier: | SPE00211227 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cccc(OC)c2C(=O)C=1 |
Species: |
4932 |
Condition: |
COT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7122±0.00212132 |
Normalized OD Score: sc h |
1.0218±0.0000963565 |
Z-Score: |
1.1312±0.0194052 |
p-Value: |
0.258 |
Z-Factor: |
-4.4341 |
Fitness Defect: |
1.3548 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2007-11-20 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00105 | Plate DMSO Control (-): | 0.6809499999999999±0.03345 | Plate Z-Factor: | 0.8541 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688669 |
5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
internal high similarity DBLink | Rows returned: 17 | << Back 1 2 3 |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|