| Compound Information | SONAR Target prediction | | Name: | 5,4`-DIMETHOXYFLAVONE | | Unique Identifier: | SPE00211227 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H14O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 17.421 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 44.76 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | COc1ccc(cc1)C1Oc2cccc(OC)c2C(=O)C=1 |
| Species: |
4932 |
| Condition: |
VPS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6667±0.0151321 |
| Normalized OD Score: sc h |
1.0854±0.0184629 |
| Z-Score: |
3.3950±0.841309 |
| p-Value: |
0.00258718 |
| Z-Factor: |
-3.50618 |
| Fitness Defect: |
5.9572 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 4|E4 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.30 Celcius | | Date: | 2007-10-03 YYYY-MM-DD | | Plate CH Control (+): | 0.040225±0.00068 | | Plate DMSO Control (-): | 0.624675±0.13361 | | Plate Z-Factor: | 0.2537 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 688669 |
5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|