Compound Information | SONAR Target prediction | Name: | 5,4`-DIMETHOXYFLAVONE | Unique Identifier: | SPE00211227 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H14O4 | Molecular Weight: | 268.18 g/mol | X log p: | 17.421 (online calculus) | Lipinksi Failures | 1 | TPSA | 44.76 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | COc1ccc(cc1)C1Oc2cccc(OC)c2C(=O)C=1 |
Species: |
4932 |
Condition: |
HTZ1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3406±0.0350725 |
Normalized OD Score: sc h |
1.2553±0.112739 |
Z-Score: |
1.0718±0.229802 |
p-Value: |
0.290144 |
Z-Factor: |
-8.71213 |
Fitness Defect: |
1.2374 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 4|E4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2007-09-26 YYYY-MM-DD | Plate CH Control (+): | 0.03985±0.00017 | Plate DMSO Control (-): | 0.2025±0.10291 | Plate Z-Factor: | -1.1688 |
| png ps pdf |
DBLink | Rows returned: 1 | |
688669 |
5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
active | Cluster 4262 | Additional Members: 9 | Rows returned: 3 | |
|